C27H26FN5O2 — CID 153461579
benzyl N-[4-[3-cyclohexyl-5-(4-fluorophenyl)imidazol-4-yl]pyrimidin-2-yl]carbamate (PubChem CID 153461579) has the molecular formula C27H26FN5O2 and a molecular weight of 471.54 g/mol. Its IUPAC name is benzyl N-[4-[3-cyclohexyl-5-(4-fluorophenyl)imidazol-4-yl]pyrimidin-2-yl]carbamate.
| Compound Name | benzyl N-[4-[3-cyclohexyl-5-(4-fluorophenyl)imidazol-4-yl]pyrimidin-2-yl]carbamate |
|---|---|
| PubChem CID | 153461579 |
| Molecular Formula | C27H26FN5O2 |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | benzyl N-[4-[3-cyclohexyl-5-(4-fluorophenyl)imidazol-4-yl]pyrimidin-2-yl]carbamate |
| SMILES | O=C(Nc1nccc(-c2c(-c3ccc(F)cc3)ncn2C2CCCCC2)n1)OCc1ccccc1 |
| InChI | InChI=1S/C27H26FN5O2/c28-21-13-11-20(12-14-21)24-25(33(18-30-24)22-9-5-2-6-10-22)23-15-16-29-26(31-23)32-27(34)35-17-19-7-3-1-4-8-19/h1,3-4,7-8,11-16,18,22H,2,5-6,9-10,17H2,(H,29,31,32,34) |
| InChIKey | PEJJETLDXDCYGY-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |