C43H36F2N4O8 — CID 58473106
CID 58473106 (PubChem CID 58473106) has the molecular formula C43H36F2N4O8 and a molecular weight of 774.78 g/mol.
| Compound Name | CID 58473106 |
|---|---|
| PubChem CID | 58473106 |
| Molecular Formula | C43H36F2N4O8 |
| Molecular Weight | 774.78 g/mol |
| Exact Mass | 774.25 |
| IUPAC Name | — |
| SMILES | [CH]OC(=O)N1c2cc(OCCCOc3cc4c(cc3C)C(=O)N3C=C(c5ccc(F)cc5)C[C@H]3C=N4)c(OC)cc2C(=O)N2C=C(c3ccc(F)cc3)C[C@H]2[C@@H]1O |
| InChI | InChI=1S/C43H36F2N4O8/c1-24-15-32-34(46-21-31-16-27(22-47(31)40(32)50)25-5-9-29(44)10-6-25)19-37(24)56-13-4-14-57-39-20-35-33(18-38(39)54-2)41(51)48-23-28(26-7-11-30(45)12-8-26)17-36(48)42(52)49(35)43(53)55-3/h3,5-12,15,18-23,31,36,42,52H,4,13-14,16-17H2,1-2H3/t31-,36-,42-/m0/s1 |
| InChIKey | FJKFEKBQOUPMBP-BFUHBQBKSA-N |
| XLogP | 7.30 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.78 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|