C36H37BN4O9 — CID 88898751
CID 88898751 (PubChem CID 88898751) has the molecular formula C36H37BN4O9 and a molecular weight of 680.52 g/mol.
| Compound Name | CID 88898751 |
|---|---|
| PubChem CID | 88898751 |
| Molecular Formula | C36H37BN4O9 |
| Molecular Weight | 680.52 g/mol |
| Exact Mass | 680.27 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)N1c2cc(OCCCOc3cc4c(cc3OC)C(=O)N3C=C(/C=C/C)C[C@H]3C=N4)c(OC)cc2C(=O)N2C=C(/C=C/C)C[C@H]2[C@@H]1O |
| InChI | InChI=1S/C36H37BN4O9/c1-5-8-21-12-23-18-38-26-16-31(29(46-3)14-24(26)33(42)39(23)19-21)48-10-7-11-49-32-17-27-25(15-30(32)47-4)34(43)40-20-22(9-6-2)13-28(40)35(44)41(27)36(45)50-37/h5-6,8-9,14-20,23,28,35,44H,7,10-13H2,1-4H3/b8-5+,9-6+/t23-,28-,35-/m0/s1 |
| InChIKey | UEGYEGZRAZMRFV-ORYWGIGNSA-N |
| XLogP | 4.98 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|