C35H32F2N2O2S2 — CID 58474605
5-[3-fluoro-4-[2-(5-hexyl-2-pyridinyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-(4-fluorophenyl)-4-sulfanylidenepentan-2-one (PubChem CID 58474605) has the molecular formula C35H32F2N2O2S2 and a molecular weight of 614.78 g/mol. Its IUPAC name is 5-[3-fluoro-4-[2-(5-hexyl-2-pyridinyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-(4-fluorophenyl)-4-sulfanylidenepentan-2-one.
| Compound Name | 5-[3-fluoro-4-[2-(5-hexyl-2-pyridinyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-(4-fluorophenyl)-4-sulfanylidenepentan-2-one |
|---|---|
| PubChem CID | 58474605 |
| Molecular Formula | C35H32F2N2O2S2 |
| Molecular Weight | 614.78 g/mol |
| Exact Mass | 614.19 |
| IUPAC Name | 5-[3-fluoro-4-[2-(5-hexyl-2-pyridinyl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-(4-fluorophenyl)-4-sulfanylidenepentan-2-one |
| SMILES | CCCCCCc1ccc(-c2cc3nccc(Oc4ccc(CC(=S)CC(=O)Cc5ccc(F)cc5)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C35H32F2N2O2S2/c1-2-3-4-5-6-24-9-13-30(39-22-24)34-21-31-35(43-34)33(15-16-38-31)41-32-14-10-25(19-29(32)37)18-28(42)20-27(40)17-23-7-11-26(36)12-8-23/h7-16,19,21-22H,2-6,17-18,20H2,1H3 |
| InChIKey | DZEXZPQUDULIGX-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.78 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|