C11H15ClF5NO4S — CID 58478683
2-chloro-5,5,6,6,6-pentafluoro-2-(oxolan-2-ylmethylsulfonyl)hexanamide (PubChem CID 58478683) has the molecular formula C11H15ClF5NO4S and a molecular weight of 387.75 g/mol. Its IUPAC name is 2-chloro-5,5,6,6,6-pentafluoro-2-(oxolan-2-ylmethylsulfonyl)hexanamide.
| Compound Name | 2-chloro-5,5,6,6,6-pentafluoro-2-(oxolan-2-ylmethylsulfonyl)hexanamide |
|---|---|
| PubChem CID | 58478683 |
| Molecular Formula | C11H15ClF5NO4S |
| Molecular Weight | 387.75 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | 2-chloro-5,5,6,6,6-pentafluoro-2-(oxolan-2-ylmethylsulfonyl)hexanamide |
| SMILES | NC(=O)C(Cl)(CCC(F)(F)C(F)(F)F)S(=O)(=O)CC1CCCO1 |
| InChI | InChI=1S/C11H15ClF5NO4S/c12-9(8(18)19,3-4-10(13,14)11(15,16)17)23(20,21)6-7-2-1-5-22-7/h7H,1-6H2,(H2,18,19) |
| InChIKey | SGXGERZLIHFVHV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.75 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|