C25H25F3O3 — CID 58481605
2-[2,6-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-4-(oxolan-3-ylmethyl)cyclopentane-1,3-dione (PubChem CID 58481605) has the molecular formula C25H25F3O3 and a molecular weight of 430.47 g/mol. Its IUPAC name is 2-[2,6-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-4-(oxolan-3-ylmethyl)cyclopentane-1,3-dione.
| Compound Name | 2-[2,6-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-4-(oxolan-3-ylmethyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 58481605 |
| Molecular Formula | C25H25F3O3 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 2-[2,6-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-4-(oxolan-3-ylmethyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(-c2ccc(C(F)(F)F)cc2)cc(C)c1C1C(=O)CC(CC2CCOC2)C1=O |
| InChI | InChI=1S/C25H25F3O3/c1-14-9-18(17-3-5-20(6-4-17)25(26,27)28)10-15(2)22(14)23-21(29)12-19(24(23)30)11-16-7-8-31-13-16/h3-6,9-10,16,19,23H,7-8,11-13H2,1-2H3 |
| InChIKey | FKLJZYBEGRNMDZ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|