About [(2R,3S)-2-[3-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)-2-oxopropyl]pyrrolidin-3-yl] propanoate
[(2R,3S)-2-[3-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)-2-oxopropyl]pyrrolidin-3-yl] propanoate (PubChem CID 58482385) has the molecular formula C18H19BrClN3O4
and a molecular weight of 456.72 g/mol. Its IUPAC name is [(2R,3S)-2-[3-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)-2-oxopropyl]pyrrolidin-3-yl] propanoate.
Molecular Properties
| Compound Name | [(2R,3S)-2-[3-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)-2-oxopropyl]pyrrolidin-3-yl] propanoate |
| PubChem CID | 58482385 |
| Molecular Formula | C18H19BrClN3O4 |
| Molecular Weight | 456.72 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | [(2R,3S)-2-[3-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)-2-oxopropyl]pyrrolidin-3-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1CCN[C@@H]1CC(=O)Cn1cnc2cc(Br)c(Cl)cc2c1=O |
| InChI | InChI=1S/C18H19BrClN3O4/c1-2-17(25)27-16-3-4-21-15(16)5-10(24)8-23-9-22-14-7-12(19)13(20)6-11(14)18(23)26/h6-7,9,15-16,21H,2-5,8H2,1H3/t15-,16+/m1/s1 |
| InChIKey | XXXMLPKPWCPLNH-CVEARBPZSA-N |
| XLogP | 2.46 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.72 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(2R,3S)-2-[3-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)-2-oxopropyl]pyrrolidin-3-yl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S)-2-[3-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)-2-oxopropyl]pyrrolidin-3-yl] propanoate?
The IUPAC name of [(2R,3S)-2-[3-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)-2-oxopropyl]pyrrolidin-3-yl] propanoate (CID 58482385) is [(2R,3S)-2-[3-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)-2-oxopropyl]pyrrolidin-3-yl] propanoate.
What is the SMILES notation for [(2R,3S)-2-[3-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)-2-oxopropyl]pyrrolidin-3-yl] propanoate?
The canonical SMILES for [(2R,3S)-2-[3-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)-2-oxopropyl]pyrrolidin-3-yl] propanoate is CCC(=O)O[C@H]1CCN[C@@H]1CC(=O)Cn1cnc2cc(Br)c(Cl)cc2c1=O.
What is the InChIKey of [(2R,3S)-2-[3-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)-2-oxopropyl]pyrrolidin-3-yl] propanoate?
The InChIKey is XXXMLPKPWCPLNH-CVEARBPZSA-N. The full InChI is InChI=1S/C18H19BrClN3O4/c1-2-17(25)27-16-3-4-21-15(16)5-10(24)8-23-9-22-14-7-12(19)13(20)6-11(14)18(23)26/h6-7,9,15-16,21H,2-5,8H2,1H3/t15-,16+/m1/s1.
What are the key properties of [(2R,3S)-2-[3-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)-2-oxopropyl]pyrrolidin-3-yl] propanoate?
[(2R,3S)-2-[3-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)-2-oxopropyl]pyrrolidin-3-yl] propanoate has a molecular weight of 456.72 g/mol, XLogP of 2.46, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S)-2-[3-(7-bromo-6-chloro-4-oxoquinazolin-3-yl)-2-oxopropyl]pyrrolidin-3-yl] propanoate is sourced from PubChem (CID 58482385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).