C16H16Cl3N3O3 — CID 58482464
6,7,8-trichloro-3-[3-[(2S,3R)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one (PubChem CID 58482464) has the molecular formula C16H16Cl3N3O3 and a molecular weight of 404.68 g/mol. Its IUPAC name is 6,7,8-trichloro-3-[3-[(2S,3R)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one.
| Compound Name | 6,7,8-trichloro-3-[3-[(2S,3R)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one |
|---|---|
| PubChem CID | 58482464 |
| Molecular Formula | C16H16Cl3N3O3 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 6,7,8-trichloro-3-[3-[(2S,3R)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one |
| SMILES | O=C(C[C@@H]1NCCC[C@H]1O)Cn1cnc2c(Cl)c(Cl)c(Cl)cc2c1=O |
| InChI | InChI=1S/C16H16Cl3N3O3/c17-10-5-9-15(14(19)13(10)18)21-7-22(16(9)25)6-8(23)4-11-12(24)2-1-3-20-11/h5,7,11-12,20,24H,1-4,6H2/t11-,12+/m0/s1 |
| InChIKey | IGZGDIBPIKMGNA-NWDGAFQWSA-N |
| XLogP | 2.43 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|