C31H32NO3+ — CID 58485521
2-[(3R)-1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl]-1-[7-(2-methoxyphenyl)-1-benzofuran-2-yl]ethanone (PubChem CID 58485521) has the molecular formula C31H32NO3+ and a molecular weight of 466.60 g/mol. Its IUPAC name is 2-[(3R)-1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl]-1-[7-(2-methoxyphenyl)-1-benzofuran-2-yl]ethanone.
| Compound Name | 2-[(3R)-1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl]-1-[7-(2-methoxyphenyl)-1-benzofuran-2-yl]ethanone |
|---|---|
| PubChem CID | 58485521 |
| Molecular Formula | C31H32NO3+ |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 2-[(3R)-1-benzyl-1-azoniabicyclo[2.2.2]octan-3-yl]-1-[7-(2-methoxyphenyl)-1-benzofuran-2-yl]ethanone |
| SMILES | COc1ccccc1-c1cccc2cc(C(=O)C[C@H]3C[N+]4(Cc5ccccc5)CCC3CC4)oc12 |
| InChI | InChI=1S/C31H32NO3/c1-34-29-13-6-5-11-26(29)27-12-7-10-24-19-30(35-31(24)27)28(33)18-25-21-32(16-14-23(25)15-17-32)20-22-8-3-2-4-9-22/h2-13,19,23,25H,14-18,20-21H2,1H3/q+1/t23?,25-,32?/m0/s1 |
| InChIKey | YGLMMDQWZJXYCI-JWALKRTLSA-N |
| XLogP | 6.74 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|