C29H34N2O4 — CID 58485623
3-[2-[2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]acetyl]-1-benzofuran-7-yl]-N-(3-ethoxypropyl)benzamide (PubChem CID 58485623) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is 3-[2-[2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]acetyl]-1-benzofuran-7-yl]-N-(3-ethoxypropyl)benzamide.
| Compound Name | 3-[2-[2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]acetyl]-1-benzofuran-7-yl]-N-(3-ethoxypropyl)benzamide |
|---|---|
| PubChem CID | 58485623 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 3-[2-[2-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]acetyl]-1-benzofuran-7-yl]-N-(3-ethoxypropyl)benzamide |
| SMILES | CCOCCCNC(=O)c1cccc(-c2cccc3cc(C(=O)C[C@@H]4CN5CCC4CC5)oc23)c1 |
| InChI | InChI=1S/C29H34N2O4/c1-2-34-15-5-12-30-29(33)23-8-3-6-21(16-23)25-9-4-7-22-18-27(35-28(22)25)26(32)17-24-19-31-13-10-20(24)11-14-31/h3-4,6-9,16,18,20,24H,2,5,10-15,17,19H2,1H3,(H,30,33)/t24-/m1/s1 |
| InChIKey | KKBNPUIYVPPKFF-XMMPIXPASA-N |
| XLogP | 5.17 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|