C19H15ClFN5O — CID 58485948
5-[[6-[(6-chloro-3-pyridinyl)methyl]-2-fluoro-3-pyridinyl]methyl]-4-methoxy-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 58485948) has the molecular formula C19H15ClFN5O and a molecular weight of 383.81 g/mol. Its IUPAC name is 5-[[6-[(6-chloro-3-pyridinyl)methyl]-2-fluoro-3-pyridinyl]methyl]-4-methoxy-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 5-[[6-[(6-chloro-3-pyridinyl)methyl]-2-fluoro-3-pyridinyl]methyl]-4-methoxy-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 58485948 |
| Molecular Formula | C19H15ClFN5O |
| Molecular Weight | 383.81 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 5-[[6-[(6-chloro-3-pyridinyl)methyl]-2-fluoro-3-pyridinyl]methyl]-4-methoxy-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | COc1ncnc2[nH]cc(Cc3ccc(Cc4ccc(Cl)nc4)nc3F)c12 |
| InChI | InChI=1S/C19H15ClFN5O/c1-27-19-16-13(9-23-18(16)24-10-25-19)7-12-3-4-14(26-17(12)21)6-11-2-5-15(20)22-8-11/h2-5,8-10H,6-7H2,1H3,(H,23,24,25) |
| InChIKey | AIPAQGZLEOJXKI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.81 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|