C19H12F4N2O — CID 58486951
N-[6-[(2,5-difluorophenyl)methyl]-3-pyridinyl]-2,6-difluorobenzamide (PubChem CID 58486951) has the molecular formula C19H12F4N2O and a molecular weight of 360.31 g/mol. Its IUPAC name is N-[6-[(2,5-difluorophenyl)methyl]-3-pyridinyl]-2,6-difluorobenzamide.
| Compound Name | N-[6-[(2,5-difluorophenyl)methyl]-3-pyridinyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 58486951 |
| Molecular Formula | C19H12F4N2O |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-[6-[(2,5-difluorophenyl)methyl]-3-pyridinyl]-2,6-difluorobenzamide |
| SMILES | O=C(Nc1ccc(Cc2cc(F)ccc2F)nc1)c1c(F)cccc1F |
| InChI | InChI=1S/C19H12F4N2O/c20-12-4-7-15(21)11(8-12)9-13-5-6-14(10-24-13)25-19(26)18-16(22)2-1-3-17(18)23/h1-8,10H,9H2,(H,25,26) |
| InChIKey | UNGZMYMOSFBDAF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |