C18H11F4N3O — CID 67126920
N-[6-(2,5-difluoroanilino)-3-pyridinyl]-2,6-difluorobenzamide (PubChem CID 67126920) has the molecular formula C18H11F4N3O and a molecular weight of 361.30 g/mol. Its IUPAC name is N-[6-(2,5-difluoroanilino)-3-pyridinyl]-2,6-difluorobenzamide.
| Compound Name | N-[6-(2,5-difluoroanilino)-3-pyridinyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 67126920 |
| Molecular Formula | C18H11F4N3O |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | N-[6-(2,5-difluoroanilino)-3-pyridinyl]-2,6-difluorobenzamide |
| SMILES | O=C(Nc1ccc(Nc2cc(F)ccc2F)nc1)c1c(F)cccc1F |
| InChI | InChI=1S/C18H11F4N3O/c19-10-4-6-12(20)15(8-10)25-16-7-5-11(9-23-16)24-18(26)17-13(21)2-1-3-14(17)22/h1-9H,(H,23,25)(H,24,26) |
| InChIKey | HDJBSPUNXMNXRW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |