C8H14N2O — CID 58488076
1-[(1S,5R)-3,6-diazabicyclo[3.2.1]octan-6-yl]ethanone (PubChem CID 58488076) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 1-[(1S,5R)-3,6-diazabicyclo[3.2.1]octan-6-yl]ethanone.
| Compound Name | 1-[(1S,5R)-3,6-diazabicyclo[3.2.1]octan-6-yl]ethanone |
|---|---|
| PubChem CID | 58488076 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 1-[(1S,5R)-3,6-diazabicyclo[3.2.1]octan-6-yl]ethanone |
| SMILES | CC(=O)N1C[C@@H]2CNC[C@H]1C2 |
| InChI | InChI=1S/C8H14N2O/c1-6(11)10-5-7-2-8(10)4-9-3-7/h7-9H,2-5H2,1H3/t7-,8+/m0/s1 |
| InChIKey | STSZDVPRZQFLRJ-JGVFFNPUSA-N |
| XLogP | -0.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |