About cyclobutyl-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-6-yl]methanone
cyclobutyl-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-6-yl]methanone (PubChem CID 58488093) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is cyclobutyl-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-6-yl]methanone.
Molecular Properties
| Compound Name | cyclobutyl-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-6-yl]methanone |
| PubChem CID | 58488093 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | cyclobutyl-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-6-yl]methanone |
| SMILES | O=C(C1CCC1)N1C[C@H]2CNC[C@@H]1C2 |
| InChI | InChI=1S/C11H18N2O/c14-11(9-2-1-3-9)13-7-8-4-10(13)6-12-5-8/h8-10,12H,1-7H2/t8-,10+/m1/s1 |
| InChIKey | ZVPVSELLYIDXQB-SCZZXKLOSA-N |
| XLogP | 0.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclobutyl-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-6-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyl-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-6-yl]methanone?
The IUPAC name of cyclobutyl-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-6-yl]methanone (CID 58488093) is cyclobutyl-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-6-yl]methanone.
What is the SMILES notation for cyclobutyl-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-6-yl]methanone?
The canonical SMILES for cyclobutyl-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-6-yl]methanone is O=C(C1CCC1)N1C[C@H]2CNC[C@@H]1C2.
What is the InChIKey of cyclobutyl-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-6-yl]methanone?
The InChIKey is ZVPVSELLYIDXQB-SCZZXKLOSA-N. The full InChI is InChI=1S/C11H18N2O/c14-11(9-2-1-3-9)13-7-8-4-10(13)6-12-5-8/h8-10,12H,1-7H2/t8-,10+/m1/s1.
What are the key properties of cyclobutyl-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-6-yl]methanone?
cyclobutyl-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-6-yl]methanone has a molecular weight of 194.28 g/mol, XLogP of 0.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl-[(1R,5S)-3,6-diazabicyclo[3.2.1]octan-6-yl]methanone is sourced from PubChem (CID 58488093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).