C12H20N2O — CID 175882089
cyclopentyl(2,5-diazabicyclo[2.2.2]octan-2-yl)methanone (PubChem CID 175882089) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is cyclopentyl(2,5-diazabicyclo[2.2.2]octan-2-yl)methanone.
| Compound Name | cyclopentyl(2,5-diazabicyclo[2.2.2]octan-2-yl)methanone |
|---|---|
| PubChem CID | 175882089 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | cyclopentyl(2,5-diazabicyclo[2.2.2]octan-2-yl)methanone |
| SMILES | O=C(C1CCCC1)N1CC2CCC1CN2 |
| InChI | InChI=1S/C12H20N2O/c15-12(9-3-1-2-4-9)14-8-10-5-6-11(14)7-13-10/h9-11,13H,1-8H2 |
| InChIKey | HUDHZXOBPPMPTG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |