About 2-methyl-2,5-diazabicyclo[2.2.2]octane;hydrochloride
2-methyl-2,5-diazabicyclo[2.2.2]octane;hydrochloride (PubChem CID 131676431) has the molecular formula C7H15ClN2
and a molecular weight of 162.66 g/mol. Its IUPAC name is 2-methyl-2,5-diazabicyclo[2.2.2]octane;hydrochloride.
Analyze 2-methyl-2,5-diazabicyclo[2.2.2]octane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,5-diazabicyclo[2.2.2]octane;hydrochloride?
The IUPAC name of 2-methyl-2,5-diazabicyclo[2.2.2]octane;hydrochloride (CID 131676431) is 2-methyl-2,5-diazabicyclo[2.2.2]octane;hydrochloride.
What is the SMILES notation for 2-methyl-2,5-diazabicyclo[2.2.2]octane;hydrochloride?
The canonical SMILES for 2-methyl-2,5-diazabicyclo[2.2.2]octane;hydrochloride is CN1CC2CCC1CN2.Cl.
What is the InChIKey of 2-methyl-2,5-diazabicyclo[2.2.2]octane;hydrochloride?
The InChIKey is WJWFYTBIUAZBGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.ClH/c1-9-5-6-2-3-7(9)4-8-6;/h6-8H,2-5H2,1H3;1H.
What are the key properties of 2-methyl-2,5-diazabicyclo[2.2.2]octane;hydrochloride?
2-methyl-2,5-diazabicyclo[2.2.2]octane;hydrochloride has a molecular weight of 162.66 g/mol, XLogP of 0.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,5-diazabicyclo[2.2.2]octane;hydrochloride is sourced from PubChem (CID 131676431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).