About 3-methyl-3,9-diazabicyclo[3.3.2]decane
3-methyl-3,9-diazabicyclo[3.3.2]decane (PubChem CID 84650080) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 3-methyl-3,9-diazabicyclo[3.3.2]decane.
Molecular Properties
| Compound Name | 3-methyl-3,9-diazabicyclo[3.3.2]decane |
| PubChem CID | 84650080 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 3-methyl-3,9-diazabicyclo[3.3.2]decane |
| SMILES | CN1CC2CCCC(C1)NC2 |
| InChI | InChI=1S/C9H18N2/c1-11-6-8-3-2-4-9(7-11)10-5-8/h8-10H,2-7H2,1H3 |
| InChIKey | OCHBGJJNQYRVKD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-3,9-diazabicyclo[3.3.2]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3,9-diazabicyclo[3.3.2]decane?
The IUPAC name of 3-methyl-3,9-diazabicyclo[3.3.2]decane (CID 84650080) is 3-methyl-3,9-diazabicyclo[3.3.2]decane.
What is the SMILES notation for 3-methyl-3,9-diazabicyclo[3.3.2]decane?
The canonical SMILES for 3-methyl-3,9-diazabicyclo[3.3.2]decane is CN1CC2CCCC(C1)NC2.
What is the InChIKey of 3-methyl-3,9-diazabicyclo[3.3.2]decane?
The InChIKey is OCHBGJJNQYRVKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-11-6-8-3-2-4-9(7-11)10-5-8/h8-10H,2-7H2,1H3.
What are the key properties of 3-methyl-3,9-diazabicyclo[3.3.2]decane?
3-methyl-3,9-diazabicyclo[3.3.2]decane has a molecular weight of 154.26 g/mol, XLogP of 0.69, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3,9-diazabicyclo[3.3.2]decane is sourced from PubChem (CID 84650080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).