C12H24N2 — CID 68531684
3-pentyl-3,6-diazabicyclo[3.2.2]nonane (PubChem CID 68531684) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 3-pentyl-3,6-diazabicyclo[3.2.2]nonane.
| Compound Name | 3-pentyl-3,6-diazabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 68531684 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 3-pentyl-3,6-diazabicyclo[3.2.2]nonane |
| SMILES | CCCCCN1CC2CCC(C1)NC2 |
| InChI | InChI=1S/C12H24N2/c1-2-3-4-7-14-9-11-5-6-12(10-14)13-8-11/h11-13H,2-10H2,1H3 |
| InChIKey | HCCSHVBZGFEJPP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|