C9H16N2 — CID 91249004
1,5-diazatricyclo[4.4.1.03,8]undecane (PubChem CID 91249004) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 1,5-diazatricyclo[4.4.1.03,8]undecane.
| Compound Name | 1,5-diazatricyclo[4.4.1.03,8]undecane |
|---|---|
| PubChem CID | 91249004 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1,5-diazatricyclo[4.4.1.03,8]undecane |
| SMILES | C1CN2CC3CC1C(CN3)C2 |
| InChI | InChI=1S/C9H16N2/c1-2-11-5-8-4-10-9(6-11)3-7(1)8/h7-10H,1-6H2 |
| InChIKey | RZZYTLWWBYSMKY-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |