About 1,4-diazatricyclo[4.3.1.13,8]undecane
1,4-diazatricyclo[4.3.1.13,8]undecane (PubChem CID 18411796) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 1,4-diazatricyclo[4.3.1.13,8]undecane.
Molecular Properties
| Compound Name | 1,4-diazatricyclo[4.3.1.13,8]undecane |
| PubChem CID | 18411796 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1,4-diazatricyclo[4.3.1.13,8]undecane |
| SMILES | C1NC2CC3CC1CN(C3)C2 |
| InChI | InChI=1S/C9H16N2/c1-7-2-9-6-11(4-7)5-8(1)3-10-9/h7-10H,1-6H2 |
| InChIKey | JMJUWQIOHYBWPM-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-diazatricyclo[4.3.1.13,8]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diazatricyclo[4.3.1.13,8]undecane?
The IUPAC name of 1,4-diazatricyclo[4.3.1.13,8]undecane (CID 18411796) is 1,4-diazatricyclo[4.3.1.13,8]undecane.
What is the SMILES notation for 1,4-diazatricyclo[4.3.1.13,8]undecane?
The canonical SMILES for 1,4-diazatricyclo[4.3.1.13,8]undecane is C1NC2CC3CC1CN(C3)C2.
What is the InChIKey of 1,4-diazatricyclo[4.3.1.13,8]undecane?
The InChIKey is JMJUWQIOHYBWPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-7-2-9-6-11(4-7)5-8(1)3-10-9/h7-10H,1-6H2.
What are the key properties of 1,4-diazatricyclo[4.3.1.13,8]undecane?
1,4-diazatricyclo[4.3.1.13,8]undecane has a molecular weight of 152.24 g/mol, XLogP of 0.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diazatricyclo[4.3.1.13,8]undecane is sourced from PubChem (CID 18411796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).