C6H12N2O — CID 170269413
2-hydroxy-2,5-diazabicyclo[2.2.2]octane (PubChem CID 170269413) has the molecular formula C6H12N2O and a molecular weight of 128.18 g/mol. Its IUPAC name is 2-hydroxy-2,5-diazabicyclo[2.2.2]octane.
| Compound Name | 2-hydroxy-2,5-diazabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 170269413 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 2-hydroxy-2,5-diazabicyclo[2.2.2]octane |
| SMILES | ON1CC2CCC1CN2 |
| InChI | InChI=1S/C6H12N2O/c9-8-4-5-1-2-6(8)3-7-5/h5-7,9H,1-4H2 |
| InChIKey | GXZTYQLRPXNOTE-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |