About [(1R,5S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-(4-hydroxycyclohexyl)methanone;hydrochloride
[(1R,5S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-(4-hydroxycyclohexyl)methanone;hydrochloride (PubChem CID 154908047) has the molecular formula C14H25ClN2O2
and a molecular weight of 288.82 g/mol. Its IUPAC name is [(1R,5S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-(4-hydroxycyclohexyl)methanone;hydrochloride.
Molecular Properties
| Compound Name | [(1R,5S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-(4-hydroxycyclohexyl)methanone;hydrochloride |
| PubChem CID | 154908047 |
| Molecular Formula | C14H25ClN2O2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | [(1R,5S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-(4-hydroxycyclohexyl)methanone;hydrochloride |
| SMILES | Cl.O=C(C1CCC(O)CC1)N1C[C@@H]2CC[C@H]1CNC2 |
| InChI | InChI=1S/C14H24N2O2.ClH/c17-13-5-2-11(3-6-13)14(18)16-9-10-1-4-12(16)8-15-7-10;/h10-13,15,17H,1-9H2;1H/t10-,11?,12+,13?;/m1./s1 |
| InChIKey | FQHAOCMVZCQVJA-PKNMQIIOSA-N |
| XLogP | 1.17 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1R,5S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-(4-hydroxycyclohexyl)methanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,5S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-(4-hydroxycyclohexyl)methanone;hydrochloride?
The IUPAC name of [(1R,5S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-(4-hydroxycyclohexyl)methanone;hydrochloride (CID 154908047) is [(1R,5S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-(4-hydroxycyclohexyl)methanone;hydrochloride.
What is the SMILES notation for [(1R,5S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-(4-hydroxycyclohexyl)methanone;hydrochloride?
The canonical SMILES for [(1R,5S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-(4-hydroxycyclohexyl)methanone;hydrochloride is Cl.O=C(C1CCC(O)CC1)N1C[C@@H]2CC[C@H]1CNC2.
What is the InChIKey of [(1R,5S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-(4-hydroxycyclohexyl)methanone;hydrochloride?
The InChIKey is FQHAOCMVZCQVJA-PKNMQIIOSA-N. The full InChI is InChI=1S/C14H24N2O2.ClH/c17-13-5-2-11(3-6-13)14(18)16-9-10-1-4-12(16)8-15-7-10;/h10-13,15,17H,1-9H2;1H/t10-,11?,12+,13?;/m1./s1.
What are the key properties of [(1R,5S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-(4-hydroxycyclohexyl)methanone;hydrochloride?
[(1R,5S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-(4-hydroxycyclohexyl)methanone;hydrochloride has a molecular weight of 288.82 g/mol, XLogP of 1.17, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,5S)-3,6-diazabicyclo[3.2.2]nonan-6-yl]-(4-hydroxycyclohexyl)methanone;hydrochloride is sourced from PubChem (CID 154908047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).