C13H23Cl2N4O2Pt- — CID 58492755
azanide;dichloroplatinum;N-hydroxy-7-[(2-methyl-4-pyridinyl)amino]heptanamide (PubChem CID 58492755) has the molecular formula C13H23Cl2N4O2Pt- and a molecular weight of 533.34 g/mol. Its IUPAC name is azanide;dichloroplatinum;N-hydroxy-7-[(2-methyl-4-pyridinyl)amino]heptanamide.
| Compound Name | azanide;dichloroplatinum;N-hydroxy-7-[(2-methyl-4-pyridinyl)amino]heptanamide |
|---|---|
| PubChem CID | 58492755 |
| Molecular Formula | C13H23Cl2N4O2Pt- |
| Molecular Weight | 533.34 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | azanide;dichloroplatinum;N-hydroxy-7-[(2-methyl-4-pyridinyl)amino]heptanamide |
| SMILES | Cc1cc(NCCCCCCC(=O)NO)ccn1.Cl[Pt]Cl.[NH2-] |
| InChI | InChI=1S/C13H21N3O2.2ClH.H2N.Pt/c1-11-10-12(7-9-14-11)15-8-5-3-2-4-6-13(17)16-18;;;;/h7,9-10,18H,2-6,8H2,1H3,(H,14,15)(H,16,17);2*1H;1H2;/q;;;-1;+2/p-2 |
| InChIKey | MCQWVAZJGUAADH-UHFFFAOYSA-L |
| XLogP | 4.35 |
| TPSA | 107.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.34 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|