C15H27N3 — CID 133492181
N-(2-methyl-4-pyridinyl)-N',N'-di(propan-2-yl)propane-1,3-diamine (PubChem CID 133492181) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is N-(2-methyl-4-pyridinyl)-N',N'-di(propan-2-yl)propane-1,3-diamine.
| Compound Name | N-(2-methyl-4-pyridinyl)-N',N'-di(propan-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 133492181 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | N-(2-methyl-4-pyridinyl)-N',N'-di(propan-2-yl)propane-1,3-diamine |
| SMILES | Cc1cc(NCCCN(C(C)C)C(C)C)ccn1 |
| InChI | InChI=1S/C15H27N3/c1-12(2)18(13(3)4)10-6-8-17-15-7-9-16-14(5)11-15/h7,9,11-13H,6,8,10H2,1-5H3,(H,16,17) |
| InChIKey | HTGHLVHHNDWOTO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|