About N-(4-methoxy-2-pyridinyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine
N-(4-methoxy-2-pyridinyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine (PubChem CID 12857633) has the molecular formula C14H25N3O
and a molecular weight of 251.37 g/mol. Its IUPAC name is N-(4-methoxy-2-pyridinyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(4-methoxy-2-pyridinyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine |
| PubChem CID | 12857633 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | N-(4-methoxy-2-pyridinyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine |
| SMILES | COc1ccnc(NCCN(C(C)C)C(C)C)c1 |
| InChI | InChI=1S/C14H25N3O/c1-11(2)17(12(3)4)9-8-16-14-10-13(18-5)6-7-15-14/h6-7,10-12H,8-9H2,1-5H3,(H,15,16) |
| InChIKey | APPWWIUGJSTIDI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-methoxy-2-pyridinyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methoxy-2-pyridinyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine?
The IUPAC name of N-(4-methoxy-2-pyridinyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine (CID 12857633) is N-(4-methoxy-2-pyridinyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine.
What is the SMILES notation for N-(4-methoxy-2-pyridinyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine?
The canonical SMILES for N-(4-methoxy-2-pyridinyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine is COc1ccnc(NCCN(C(C)C)C(C)C)c1.
What is the InChIKey of N-(4-methoxy-2-pyridinyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine?
The InChIKey is APPWWIUGJSTIDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N3O/c1-11(2)17(12(3)4)9-8-16-14-10-13(18-5)6-7-15-14/h6-7,10-12H,8-9H2,1-5H3,(H,15,16).
What are the key properties of N-(4-methoxy-2-pyridinyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine?
N-(4-methoxy-2-pyridinyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine has a molecular weight of 251.37 g/mol, XLogP of 2.62, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methoxy-2-pyridinyl)-N',N'-di(propan-2-yl)ethane-1,2-diamine is sourced from PubChem (CID 12857633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).