C12H20N2O — CID 115922894
N-(3,3-dimethylbutan-2-yl)-4-methoxypyridin-2-amine (PubChem CID 115922894) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-4-methoxypyridin-2-amine.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-4-methoxypyridin-2-amine |
|---|---|
| PubChem CID | 115922894 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-4-methoxypyridin-2-amine |
| SMILES | COc1ccnc(NC(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C12H20N2O/c1-9(12(2,3)4)14-11-8-10(15-5)6-7-13-11/h6-9H,1-5H3,(H,13,14) |
| InChIKey | KNDMUNQTRJXSEQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |