N-(4-methoxy-2-pyridinyl)-methylboronamidic acid

C7H11BN2O2 — CID 58334975

IUPACN-(4-methoxy-2-pyridinyl)-methylboronamidic acid
SMILESCOc1ccnc(NB(C)O)c1
InChIInChI=1S/C7H11BN2O2/c1-8(11)10-7-5-6(12-2)3-4-9-7/h3-5,11H,1-2H3,(H,9,10)
InChIKeyGUKOHTMNJGWXET-UHFFFAOYSA-N
MW165.99 g/mol
LogP0.61
Rot. Bonds3

About N-(4-methoxy-2-pyridinyl)-methylboronamidic acid

N-(4-methoxy-2-pyridinyl)-methylboronamidic acid (PubChem CID 58334975) has the molecular formula C7H11BN2O2 and a molecular weight of 165.99 g/mol. Its IUPAC name is N-(4-methoxy-2-pyridinyl)-methylboronamidic acid.

Molecular Properties

Compound NameN-(4-methoxy-2-pyridinyl)-methylboronamidic acid
PubChem CID58334975
Molecular FormulaC7H11BN2O2
Molecular Weight165.99 g/mol
Exact Mass166.09
IUPAC NameN-(4-methoxy-2-pyridinyl)-methylboronamidic acid
SMILESCOc1ccnc(NB(C)O)c1
InChIInChI=1S/C7H11BN2O2/c1-8(11)10-7-5-6(12-2)3-4-9-7/h3-5,11H,1-2H3,(H,9,10)
InChIKeyGUKOHTMNJGWXET-UHFFFAOYSA-N
XLogP0.61
TPSA54.38 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500165.99
LogP ≤ 50.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze N-(4-methoxy-2-pyridinyl)-methylboronamidic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(4-methoxy-2-pyridinyl)-methylboronamidic acid?
The IUPAC name of N-(4-methoxy-2-pyridinyl)-methylboronamidic acid (CID 58334975) is N-(4-methoxy-2-pyridinyl)-methylboronamidic acid.
What is the SMILES notation for N-(4-methoxy-2-pyridinyl)-methylboronamidic acid?
The canonical SMILES for N-(4-methoxy-2-pyridinyl)-methylboronamidic acid is COc1ccnc(NB(C)O)c1.
What is the InChIKey of N-(4-methoxy-2-pyridinyl)-methylboronamidic acid?
The InChIKey is GUKOHTMNJGWXET-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BN2O2/c1-8(11)10-7-5-6(12-2)3-4-9-7/h3-5,11H,1-2H3,(H,9,10).
What are the key properties of N-(4-methoxy-2-pyridinyl)-methylboronamidic acid?
N-(4-methoxy-2-pyridinyl)-methylboronamidic acid has a molecular weight of 165.99 g/mol, XLogP of 0.61, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methoxy-2-pyridinyl)-methylboronamidic acid is sourced from PubChem (CID 58334975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).