C7H11BN2O2 — CID 58334975
N-(4-methoxy-2-pyridinyl)-methylboronamidic acid (PubChem CID 58334975) has the molecular formula C7H11BN2O2 and a molecular weight of 165.99 g/mol. Its IUPAC name is N-(4-methoxy-2-pyridinyl)-methylboronamidic acid.
| Compound Name | N-(4-methoxy-2-pyridinyl)-methylboronamidic acid |
|---|---|
| PubChem CID | 58334975 |
| Molecular Formula | C7H11BN2O2 |
| Molecular Weight | 165.99 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | N-(4-methoxy-2-pyridinyl)-methylboronamidic acid |
| SMILES | COc1ccnc(NB(C)O)c1 |
| InChI | InChI=1S/C7H11BN2O2/c1-8(11)10-7-5-6(12-2)3-4-9-7/h3-5,11H,1-2H3,(H,9,10) |
| InChIKey | GUKOHTMNJGWXET-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.99 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|