C11H13N3OS — CID 115922887
4-methoxy-N-[1-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine (PubChem CID 115922887) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 4-methoxy-N-[1-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine.
| Compound Name | 4-methoxy-N-[1-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 115922887 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 4-methoxy-N-[1-(1,3-thiazol-4-yl)ethyl]pyridin-2-amine |
| SMILES | COc1ccnc(NC(C)c2cscn2)c1 |
| InChI | InChI=1S/C11H13N3OS/c1-8(10-6-16-7-13-10)14-11-5-9(15-2)3-4-12-11/h3-8H,1-2H3,(H,12,14) |
| InChIKey | YZBPHAMXKXARQU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |