C13H15ClN2O2S — CID 115923135
2-chloro-4,5-dimethoxy-N-[1-(1,3-thiazol-4-yl)ethyl]aniline (PubChem CID 115923135) has the molecular formula C13H15ClN2O2S and a molecular weight of 298.80 g/mol. Its IUPAC name is 2-chloro-4,5-dimethoxy-N-[1-(1,3-thiazol-4-yl)ethyl]aniline.
| Compound Name | 2-chloro-4,5-dimethoxy-N-[1-(1,3-thiazol-4-yl)ethyl]aniline |
|---|---|
| PubChem CID | 115923135 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 2-chloro-4,5-dimethoxy-N-[1-(1,3-thiazol-4-yl)ethyl]aniline |
| SMILES | COc1cc(Cl)c(NC(C)c2cscn2)cc1OC |
| InChI | InChI=1S/C13H15ClN2O2S/c1-8(11-6-19-7-15-11)16-10-5-13(18-3)12(17-2)4-9(10)14/h4-8,16H,1-3H3 |
| InChIKey | HAECRFXXSCSEKW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|