C13H20ClNO4S — CID 115923136
2-chloro-N-(1-ethylsulfonylpropan-2-yl)-4,5-dimethoxyaniline (PubChem CID 115923136) has the molecular formula C13H20ClNO4S and a molecular weight of 321.83 g/mol. Its IUPAC name is 2-chloro-N-(1-ethylsulfonylpropan-2-yl)-4,5-dimethoxyaniline.
| Compound Name | 2-chloro-N-(1-ethylsulfonylpropan-2-yl)-4,5-dimethoxyaniline |
|---|---|
| PubChem CID | 115923136 |
| Molecular Formula | C13H20ClNO4S |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-chloro-N-(1-ethylsulfonylpropan-2-yl)-4,5-dimethoxyaniline |
| SMILES | CCS(=O)(=O)CC(C)Nc1cc(OC)c(OC)cc1Cl |
| InChI | InChI=1S/C13H20ClNO4S/c1-5-20(16,17)8-9(2)15-11-7-13(19-4)12(18-3)6-10(11)14/h6-7,9,15H,5,8H2,1-4H3 |
| InChIKey | IPVUOHJIIFGFOV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|