C14H20ClNO2 — CID 113429521
4-chloro-N-hex-5-en-2-yl-2,5-dimethoxyaniline (PubChem CID 113429521) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is 4-chloro-N-hex-5-en-2-yl-2,5-dimethoxyaniline.
| Compound Name | 4-chloro-N-hex-5-en-2-yl-2,5-dimethoxyaniline |
|---|---|
| PubChem CID | 113429521 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4-chloro-N-hex-5-en-2-yl-2,5-dimethoxyaniline |
| SMILES | C=CCCC(C)Nc1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C14H20ClNO2/c1-5-6-7-10(2)16-12-9-13(17-3)11(15)8-14(12)18-4/h5,8-10,16H,1,6-7H2,2-4H3 |
| InChIKey | HNWTXBWUMNWZIV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|