C16H25ClN2O2 — CID 79537185
5-chloro-2,4-dimethoxy-N-(1-piperidin-2-ylpropan-2-yl)aniline (PubChem CID 79537185) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is 5-chloro-2,4-dimethoxy-N-(1-piperidin-2-ylpropan-2-yl)aniline.
| Compound Name | 5-chloro-2,4-dimethoxy-N-(1-piperidin-2-ylpropan-2-yl)aniline |
|---|---|
| PubChem CID | 79537185 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 5-chloro-2,4-dimethoxy-N-(1-piperidin-2-ylpropan-2-yl)aniline |
| SMILES | COc1cc(OC)c(NC(C)CC2CCCCN2)cc1Cl |
| InChI | InChI=1S/C16H25ClN2O2/c1-11(8-12-6-4-5-7-18-12)19-14-9-13(17)15(20-2)10-16(14)21-3/h9-12,18-19H,4-8H2,1-3H3 |
| InChIKey | ANGZHSLCVXLUEU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|