C11H9BrF2N2S — CID 102852908
5-bromo-2,4-difluoro-N-[1-(1,3-thiazol-4-yl)ethyl]aniline (PubChem CID 102852908) has the molecular formula C11H9BrF2N2S and a molecular weight of 319.17 g/mol. Its IUPAC name is 5-bromo-2,4-difluoro-N-[1-(1,3-thiazol-4-yl)ethyl]aniline.
| Compound Name | 5-bromo-2,4-difluoro-N-[1-(1,3-thiazol-4-yl)ethyl]aniline |
|---|---|
| PubChem CID | 102852908 |
| Molecular Formula | C11H9BrF2N2S |
| Molecular Weight | 319.17 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | 5-bromo-2,4-difluoro-N-[1-(1,3-thiazol-4-yl)ethyl]aniline |
| SMILES | CC(Nc1cc(Br)c(F)cc1F)c1cscn1 |
| InChI | InChI=1S/C11H9BrF2N2S/c1-6(11-4-17-5-15-11)16-10-2-7(12)8(13)3-9(10)14/h2-6,16H,1H3 |
| InChIKey | NZJMELIEJDIGBG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.17 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|