C13H14FN3OS — CID 115925911
N-[2-fluoro-5-[1-(1,3-thiazol-4-yl)ethylamino]phenyl]acetamide (PubChem CID 115925911) has the molecular formula C13H14FN3OS and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[2-fluoro-5-[1-(1,3-thiazol-4-yl)ethylamino]phenyl]acetamide.
| Compound Name | N-[2-fluoro-5-[1-(1,3-thiazol-4-yl)ethylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 115925911 |
| Molecular Formula | C13H14FN3OS |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | N-[2-fluoro-5-[1-(1,3-thiazol-4-yl)ethylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(NC(C)c2cscn2)ccc1F |
| InChI | InChI=1S/C13H14FN3OS/c1-8(13-6-19-7-15-13)16-10-3-4-11(14)12(5-10)17-9(2)18/h3-8,16H,1-2H3,(H,17,18) |
| InChIKey | UEWRTYPXCCKEHD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |