C12H13N3OS — CID 115928538
3-[1-(1,3-thiazol-4-yl)ethylamino]benzamide (PubChem CID 115928538) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is 3-[1-(1,3-thiazol-4-yl)ethylamino]benzamide.
| Compound Name | 3-[1-(1,3-thiazol-4-yl)ethylamino]benzamide |
|---|---|
| PubChem CID | 115928538 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 3-[1-(1,3-thiazol-4-yl)ethylamino]benzamide |
| SMILES | CC(Nc1cccc(C(N)=O)c1)c1cscn1 |
| InChI | InChI=1S/C12H13N3OS/c1-8(11-6-17-7-14-11)15-10-4-2-3-9(5-10)12(13)16/h2-8,15H,1H3,(H2,13,16) |
| InChIKey | UPVKJUSJWIDNIG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |