C15H16FN3O — CID 60927576
N-[2-fluoro-5-(1-pyridin-4-ylethylamino)phenyl]acetamide (PubChem CID 60927576) has the molecular formula C15H16FN3O and a molecular weight of 273.31 g/mol. Its IUPAC name is N-[2-fluoro-5-(1-pyridin-4-ylethylamino)phenyl]acetamide.
| Compound Name | N-[2-fluoro-5-(1-pyridin-4-ylethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 60927576 |
| Molecular Formula | C15H16FN3O |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-[2-fluoro-5-(1-pyridin-4-ylethylamino)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(NC(C)c2ccncc2)ccc1F |
| InChI | InChI=1S/C15H16FN3O/c1-10(12-5-7-17-8-6-12)18-13-3-4-14(16)15(9-13)19-11(2)20/h3-10,18H,1-2H3,(H,19,20) |
| InChIKey | BPZWXHQOTQQRCZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |