C13H16BrFN2O2 — CID 43347135
N-(3-acetamido-4-fluorophenyl)-2-bromo-3-methylbutanamide (PubChem CID 43347135) has the molecular formula C13H16BrFN2O2 and a molecular weight of 331.19 g/mol. Its IUPAC name is N-(3-acetamido-4-fluorophenyl)-2-bromo-3-methylbutanamide.
| Compound Name | N-(3-acetamido-4-fluorophenyl)-2-bromo-3-methylbutanamide |
|---|---|
| PubChem CID | 43347135 |
| Molecular Formula | C13H16BrFN2O2 |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | N-(3-acetamido-4-fluorophenyl)-2-bromo-3-methylbutanamide |
| SMILES | CC(=O)Nc1cc(NC(=O)C(Br)C(C)C)ccc1F |
| InChI | InChI=1S/C13H16BrFN2O2/c1-7(2)12(14)13(19)17-9-4-5-10(15)11(6-9)16-8(3)18/h4-7,12H,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | IBRQOXIPMQAPJV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|