C25H31N5O3S — CID 58499546
N-[(1R)-1-[4-ethyl-5-(1H-indol-6-yloxy)-1,2,4-triazol-3-yl]ethyl]-2,3,4,5,6-pentamethylbenzenesulfonamide (PubChem CID 58499546) has the molecular formula C25H31N5O3S and a molecular weight of 481.62 g/mol. Its IUPAC name is N-[(1R)-1-[4-ethyl-5-(1H-indol-6-yloxy)-1,2,4-triazol-3-yl]ethyl]-2,3,4,5,6-pentamethylbenzenesulfonamide.
| Compound Name | N-[(1R)-1-[4-ethyl-5-(1H-indol-6-yloxy)-1,2,4-triazol-3-yl]ethyl]-2,3,4,5,6-pentamethylbenzenesulfonamide |
|---|---|
| PubChem CID | 58499546 |
| Molecular Formula | C25H31N5O3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | N-[(1R)-1-[4-ethyl-5-(1H-indol-6-yloxy)-1,2,4-triazol-3-yl]ethyl]-2,3,4,5,6-pentamethylbenzenesulfonamide |
| SMILES | CCn1c(Oc2ccc3cc[nH]c3c2)nnc1[C@@H](C)NS(=O)(=O)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C25H31N5O3S/c1-8-30-24(27-28-25(30)33-21-10-9-20-11-12-26-22(20)13-21)19(7)29-34(31,32)23-17(5)15(3)14(2)16(4)18(23)6/h9-13,19,26,29H,8H2,1-7H3/t19-/m1/s1 |
| InChIKey | CAYBCHNZRHCIDU-LJQANCHMSA-N |
| XLogP | 5.15 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |