C20H18ClF2N5O3S — CID 58500117
5-chloro-N-[(1R)-1-[4-ethyl-5-(1H-indol-6-yloxy)-1,2,4-triazol-3-yl]ethyl]-2,4-difluorobenzenesulfonamide (PubChem CID 58500117) has the molecular formula C20H18ClF2N5O3S and a molecular weight of 481.91 g/mol. Its IUPAC name is 5-chloro-N-[(1R)-1-[4-ethyl-5-(1H-indol-6-yloxy)-1,2,4-triazol-3-yl]ethyl]-2,4-difluorobenzenesulfonamide.
| Compound Name | 5-chloro-N-[(1R)-1-[4-ethyl-5-(1H-indol-6-yloxy)-1,2,4-triazol-3-yl]ethyl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 58500117 |
| Molecular Formula | C20H18ClF2N5O3S |
| Molecular Weight | 481.91 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 5-chloro-N-[(1R)-1-[4-ethyl-5-(1H-indol-6-yloxy)-1,2,4-triazol-3-yl]ethyl]-2,4-difluorobenzenesulfonamide |
| SMILES | CCn1c(Oc2ccc3cc[nH]c3c2)nnc1[C@@H](C)NS(=O)(=O)c1cc(Cl)c(F)cc1F |
| InChI | InChI=1S/C20H18ClF2N5O3S/c1-3-28-19(11(2)27-32(29,30)18-9-14(21)15(22)10-16(18)23)25-26-20(28)31-13-5-4-12-6-7-24-17(12)8-13/h4-11,24,27H,3H2,1-2H3/t11-/m1/s1 |
| InChIKey | QABQLBFPGYLYGX-LLVKDONJSA-N |
| XLogP | 4.54 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.91 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|