C17H19FN6 — CID 58504604
4-[6-[(3R)-3-aminopiperidin-1-yl]-2-(methylamino)pyrimidin-4-yl]-2-fluorobenzonitrile (PubChem CID 58504604) has the molecular formula C17H19FN6 and a molecular weight of 326.38 g/mol. Its IUPAC name is 4-[6-[(3R)-3-aminopiperidin-1-yl]-2-(methylamino)pyrimidin-4-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[6-[(3R)-3-aminopiperidin-1-yl]-2-(methylamino)pyrimidin-4-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 58504604 |
| Molecular Formula | C17H19FN6 |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 4-[6-[(3R)-3-aminopiperidin-1-yl]-2-(methylamino)pyrimidin-4-yl]-2-fluorobenzonitrile |
| SMILES | CNc1nc(-c2ccc(C#N)c(F)c2)cc(N2CCC[C@@H](N)C2)n1 |
| InChI | InChI=1S/C17H19FN6/c1-21-17-22-15(11-4-5-12(9-19)14(18)7-11)8-16(23-17)24-6-2-3-13(20)10-24/h4-5,7-8,13H,2-3,6,10,20H2,1H3,(H,21,22,23)/t13-/m1/s1 |
| InChIKey | KPRWVBNICOKGAK-CYBMUJFWSA-N |
| XLogP | 2.12 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |