C18H18FN5O — CID 91595542
2-[4-(4-cyano-3-fluorophenyl)-6-piperidin-1-ylpyrimidin-2-yl]acetamide (PubChem CID 91595542) has the molecular formula C18H18FN5O and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-[4-(4-cyano-3-fluorophenyl)-6-piperidin-1-ylpyrimidin-2-yl]acetamide.
| Compound Name | 2-[4-(4-cyano-3-fluorophenyl)-6-piperidin-1-ylpyrimidin-2-yl]acetamide |
|---|---|
| PubChem CID | 91595542 |
| Molecular Formula | C18H18FN5O |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-[4-(4-cyano-3-fluorophenyl)-6-piperidin-1-ylpyrimidin-2-yl]acetamide |
| SMILES | N#Cc1ccc(-c2cc(N3CCCCC3)nc(CC(N)=O)n2)cc1F |
| InChI | InChI=1S/C18H18FN5O/c19-14-8-12(4-5-13(14)11-20)15-9-18(24-6-2-1-3-7-24)23-17(22-15)10-16(21)25/h4-5,8-9H,1-3,6-7,10H2,(H2,21,25) |
| InChIKey | BFXYNIMKQQYTPL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |