C21H19F2N2O3+ — CID 58505734
1-[4-(difluoromethoxy)phenyl]-2-[4-[(6-methyl-2-pyridinyl)methoxy]pyridin-1-ium-1-yl]ethanone (PubChem CID 58505734) has the molecular formula C21H19F2N2O3+ and a molecular weight of 385.39 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-2-[4-[(6-methyl-2-pyridinyl)methoxy]pyridin-1-ium-1-yl]ethanone.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-2-[4-[(6-methyl-2-pyridinyl)methoxy]pyridin-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 58505734 |
| Molecular Formula | C21H19F2N2O3+ |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-2-[4-[(6-methyl-2-pyridinyl)methoxy]pyridin-1-ium-1-yl]ethanone |
| SMILES | Cc1cccc(COc2cc[n+](CC(=O)c3ccc(OC(F)F)cc3)cc2)n1 |
| InChI | InChI=1S/C21H19F2N2O3/c1-15-3-2-4-17(24-15)14-27-18-9-11-25(12-10-18)13-20(26)16-5-7-19(8-6-16)28-21(22)23/h2-12,21H,13-14H2,1H3/q+1 |
| InChIKey | KABTVLYKSJEUJJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|