C21H18BrF3N2O3 — CID 87226865
2-[4-[(6-methyl-2-pyridinyl)methoxy]pyridin-1-ium-1-yl]-1-[4-(trifluoromethoxy)phenyl]ethanone bromide (PubChem CID 87226865) has the molecular formula C21H18BrF3N2O3 and a molecular weight of 483.28 g/mol. Its IUPAC name is 2-[4-[(6-methyl-2-pyridinyl)methoxy]pyridin-1-ium-1-yl]-1-[4-(trifluoromethoxy)phenyl]ethanone bromide.
| Compound Name | 2-[4-[(6-methyl-2-pyridinyl)methoxy]pyridin-1-ium-1-yl]-1-[4-(trifluoromethoxy)phenyl]ethanone bromide |
|---|---|
| PubChem CID | 87226865 |
| Molecular Formula | C21H18BrF3N2O3 |
| Molecular Weight | 483.28 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 2-[4-[(6-methyl-2-pyridinyl)methoxy]pyridin-1-ium-1-yl]-1-[4-(trifluoromethoxy)phenyl]ethanone bromide |
| SMILES | Cc1cccc(COc2cc[n+](CC(=O)c3ccc(OC(F)(F)F)cc3)cc2)n1.[Br-] |
| InChI | InChI=1S/C21H18F3N2O3.BrH/c1-15-3-2-4-17(25-15)14-28-18-9-11-26(12-10-18)13-20(27)16-5-7-19(8-6-16)29-21(22,23)24;/h2-12H,13-14H2,1H3;1H/q+1;/p-1 |
| InChIKey | QEKMYSDUYKPIKL-UHFFFAOYSA-M |
| XLogP | 1.04 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|