C34H45F3N6O4S — CID 58506253
3-methoxy-4-[[4-[2-[4-methyl-2-[methyl(methylsulfonyl)amino]phenyl]ethyl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)benzamide (PubChem CID 58506253) has the molecular formula C34H45F3N6O4S and a molecular weight of 690.83 g/mol. Its IUPAC name is 3-methoxy-4-[[4-[2-[4-methyl-2-[methyl(methylsulfonyl)amino]phenyl]ethyl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)benzamide.
| Compound Name | 3-methoxy-4-[[4-[2-[4-methyl-2-[methyl(methylsulfonyl)amino]phenyl]ethyl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 58506253 |
| Molecular Formula | C34H45F3N6O4S |
| Molecular Weight | 690.83 g/mol |
| Exact Mass | 690.32 |
| IUPAC Name | 3-methoxy-4-[[4-[2-[4-methyl-2-[methyl(methylsulfonyl)amino]phenyl]ethyl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)benzamide |
| SMILES | COc1cc(C(=O)NC2CC(C)(C)N(C)C(C)(C)C2)ccc1Nc1ncc(C(F)(F)F)c(CCc2ccc(C)cc2N(C)S(C)(=O)=O)n1 |
| InChI | InChI=1S/C34H45F3N6O4S/c1-21-10-11-22(28(16-21)42(6)48(9,45)46)12-14-26-25(34(35,36)37)20-38-31(40-26)41-27-15-13-23(17-29(27)47-8)30(44)39-24-18-32(2,3)43(7)33(4,5)19-24/h10-11,13,15-17,20,24H,12,14,18-19H2,1-9H3,(H,39,44)(H,38,40,41) |
| InChIKey | OEVWJRCYRPVDRB-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.83 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |