C15H18F4O3 — CID 58509551
(3R)-5-(5-fluoro-2-methylphenyl)-3-hydroxy-5-methyl-3-(trifluoromethyl)hexanoic acid (PubChem CID 58509551) has the molecular formula C15H18F4O3 and a molecular weight of 322.30 g/mol. Its IUPAC name is (3R)-5-(5-fluoro-2-methylphenyl)-3-hydroxy-5-methyl-3-(trifluoromethyl)hexanoic acid.
| Compound Name | (3R)-5-(5-fluoro-2-methylphenyl)-3-hydroxy-5-methyl-3-(trifluoromethyl)hexanoic acid |
|---|---|
| PubChem CID | 58509551 |
| Molecular Formula | C15H18F4O3 |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (3R)-5-(5-fluoro-2-methylphenyl)-3-hydroxy-5-methyl-3-(trifluoromethyl)hexanoic acid |
| SMILES | Cc1ccc(F)cc1C(C)(C)C[C@@](O)(CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C15H18F4O3/c1-9-4-5-10(16)6-11(9)13(2,3)8-14(22,7-12(20)21)15(17,18)19/h4-6,22H,7-8H2,1-3H3,(H,20,21)/t14-/m0/s1 |
| InChIKey | WTUCYPKVZVOQTD-AWEZNQCLSA-N |
| XLogP | 3.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |