C16H16N4O — CID 58512347
N,N-dimethyl-3-(1H-pyrrolo[2,3-b]pyridin-6-ylamino)benzamide (PubChem CID 58512347) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is N,N-dimethyl-3-(1H-pyrrolo[2,3-b]pyridin-6-ylamino)benzamide.
| Compound Name | N,N-dimethyl-3-(1H-pyrrolo[2,3-b]pyridin-6-ylamino)benzamide |
|---|---|
| PubChem CID | 58512347 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | N,N-dimethyl-3-(1H-pyrrolo[2,3-b]pyridin-6-ylamino)benzamide |
| SMILES | CN(C)C(=O)c1cccc(Nc2ccc3cc[nH]c3n2)c1 |
| InChI | InChI=1S/C16H16N4O/c1-20(2)16(21)12-4-3-5-13(10-12)18-14-7-6-11-8-9-17-15(11)19-14/h3-10H,1-2H3,(H2,17,18,19) |
| InChIKey | LHSKPHXOMAXBQL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |