C19H28BrN5O5 — CID 58515978
tert-butyl 4-[5-bromo-6-(formamidomethyl)-3-[methoxy(methyl)carbamoyl]-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 58515978) has the molecular formula C19H28BrN5O5 and a molecular weight of 486.37 g/mol. Its IUPAC name is tert-butyl 4-[5-bromo-6-(formamidomethyl)-3-[methoxy(methyl)carbamoyl]-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-bromo-6-(formamidomethyl)-3-[methoxy(methyl)carbamoyl]-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58515978 |
| Molecular Formula | C19H28BrN5O5 |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | tert-butyl 4-[5-bromo-6-(formamidomethyl)-3-[methoxy(methyl)carbamoyl]-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CON(C)C(=O)c1cc(Br)c(CNC=O)nc1N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H28BrN5O5/c1-19(2,3)30-18(28)25-8-6-24(7-9-25)16-13(17(27)23(4)29-5)10-14(20)15(22-16)11-21-12-26/h10,12H,6-9,11H2,1-5H3,(H,21,26) |
| InChIKey | YXLURBGINHPKPD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|