C13H21BrN6O2 — CID 58447020
tert-butyl 4-(5-bromo-3-hydrazinylpyrazin-2-yl)piperazine-1-carboxylate (PubChem CID 58447020) has the molecular formula C13H21BrN6O2 and a molecular weight of 373.26 g/mol. Its IUPAC name is tert-butyl 4-(5-bromo-3-hydrazinylpyrazin-2-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-bromo-3-hydrazinylpyrazin-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58447020 |
| Molecular Formula | C13H21BrN6O2 |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | tert-butyl 4-(5-bromo-3-hydrazinylpyrazin-2-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ncc(Br)nc2NN)CC1 |
| InChI | InChI=1S/C13H21BrN6O2/c1-13(2,3)22-12(21)20-6-4-19(5-7-20)11-10(18-15)17-9(14)8-16-11/h8H,4-7,15H2,1-3H3,(H,17,18) |
| InChIKey | XLJQCMRJDBRVAP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|