C10H16O2 — CID 58517086
methyl 4,5-dimethylcyclohex-2-ene-1-carboxylate (PubChem CID 58517086) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is methyl 4,5-dimethylcyclohex-2-ene-1-carboxylate.
| Compound Name | methyl 4,5-dimethylcyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 58517086 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | methyl 4,5-dimethylcyclohex-2-ene-1-carboxylate |
| SMILES | COC(=O)C1C=CC(C)C(C)C1 |
| InChI | InChI=1S/C10H16O2/c1-7-4-5-9(6-8(7)2)10(11)12-3/h4-5,7-9H,6H2,1-3H3 |
| InChIKey | BPTHMINIGMBCDF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|